Difference between revisions of "Trans-D3-cis-D7-tetradecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10459 == * left end position: ** 4527 * transcription direction: ** NEGATIVE * right end position: ** 7813 * centisome position: ** 53.0901...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * inchi key: ** InChIKey=YJVOWRAWF...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10459 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] ==
−
* left end position:
+
* smiles:
−
** 4527
+
** CCC(O)(C)C(=O)C(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
−
* right end position:
+
* common name:
−
** 7813
+
** (R)-3-hydroxy-3-methyl-2-oxopentanoate
−
* centisome position:
+
* molecular weight:
−
** 53.090183    
+
** 145.135    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.5.1.98-RXN]]
+
* [[R05068]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
* [[RXN-14106]]
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4527}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20846131 20846131]
−
{{#set: right end position=7813}}
+
* CHEBI:
−
{{#set: centisome position=53.090183   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49257 49257]
−
{{#set: reaction associated=3.5.1.98-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463]
 +
{{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}}
 +
{{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}}
 +
{{#set: molecular weight=145.135   }}
 +
{{#set: consumed by=R05068}}
 +
{{#set: reversible reaction associated=RXN-14106}}

Revision as of 18:52, 18 March 2018

Metabolite CPD-15104

  • smiles:
    • CCC(O)(C)C(=O)C(=O)[O-]
  • inchi key:
    • InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
  • common name:
    • (R)-3-hydroxy-3-methyl-2-oxopentanoate
  • molecular weight:
    • 145.135
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(O)(C)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Trans-D3-cis-D7-tetradecenoyl-ACPs&oldid=27477"