Difference between revisions of "Tiso gene 19078"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLARSONATE METHYLARSONATE] == * smiles: ** C[As](=O)([O-])O * inchi key: ** InChIKey=QYPPRT...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLARSONATE METHYLARSONATE] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C[As](=O)([O-])O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QYPPRTNMGCREIM-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** methylarsonate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 138.962 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** MMAV |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.1.1.137-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460701 5460701] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4574177.html 4574177] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33409 33409] |
− | {{#set: smiles=C | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07294 C07294] |
− | {{#set: common name= | + | * HMDB : HMDB12258 |
− | {{#set: molecular weight= | + | {{#set: smiles=C[As](=O)([O-])O}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=QYPPRTNMGCREIM-UHFFFAOYSA-M}} |
− | {{#set: | + | {{#set: common name=methylarsonate}} |
+ | {{#set: molecular weight=138.962 }} | ||
+ | {{#set: common name=MMAV}} | ||
+ | {{#set: produced by=2.1.1.137-RXN}} |
Revision as of 19:52, 18 March 2018
Contents
Metabolite METHYLARSONATE
- smiles:
- C[As](=O)([O-])O
- inchi key:
- InChIKey=QYPPRTNMGCREIM-UHFFFAOYSA-M
- common name:
- methylarsonate
- molecular weight:
- 138.962
- Synonym(s):
- MMAV
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[As](=O)([O-])O" cannot be used as a page name in this wiki.