Difference between revisions of "URIDYLYL-PROTEIN-PII"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2113 CPD0-2113] == * smiles: ** CCCCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-] * inchi key:...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2113 CPD0-2113] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=LAYXSTYJRSVXIH-HXUWFJFHSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 1-stearoyl-sn-glycerol 3-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 436.524 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-octadecanoyl-sn-glycerol 3-phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16025]] | ||
| + | * [[RXN-16077]] | ||
| + | * [[RXN-16067]] | ||
| + | * [[RXN-16076]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859619 49859619] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74565 74565] |
| − | * | + | * BIGG : 1odecg3p |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC74565 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CCCCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=LAYXSTYJRSVXIH-HXUWFJFHSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: common name=1-stearoyl-sn-glycerol 3-phosphate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=436.524 }} |
| − | {{#set: consumed | + | {{#set: common name=1-octadecanoyl-sn-glycerol 3-phosphate}} |
| + | {{#set: consumed by=RXN-16025|RXN-16077|RXN-16067|RXN-16076}} | ||
Revision as of 18:54, 18 March 2018
Contents
Metabolite CPD0-2113
- smiles:
- CCCCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-]
- inchi key:
- InChIKey=LAYXSTYJRSVXIH-HXUWFJFHSA-L
- common name:
- 1-stearoyl-sn-glycerol 3-phosphate
- molecular weight:
- 436.524
- Synonym(s):
- 1-octadecanoyl-sn-glycerol 3-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
