Difference between revisions of "D-SEDOHEPTULOSE-1-7-P2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_9591 == * left end position: ** 5615 * transcription direction: ** POSITIVE * right end position: ** 8381 * centisome position: ** 60.92004...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9591 == |
− | * | + | * left end position: |
− | ** | + | ** 5615 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 8381 |
− | * | + | * centisome position: |
− | ** | + | ** 60.92004 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5615}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=8381}} | |
− | + | {{#set: centisome position=60.92004 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 00:02, 19 March 2018
Gene Tiso_gene_9591
- left end position:
- 5615
- transcription direction:
- POSITIVE
- right end position:
- 8381
- centisome position:
- 60.92004
- Synonym(s):
Reactions associated
- PEPTIDYLPROLYL-ISOMERASE-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation