Difference between revisions of "Tiso gene 15094"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...")
(Created page with "Category:Gene == Gene Tiso_gene_13463 == * left end position: ** 2389 * transcription direction: ** POSITIVE * right end position: ** 4689 * centisome position: ** 38.0777...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
+
== Gene Tiso_gene_13463 ==
−
* smiles:
+
* left end position:
−
** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
+
** 2389
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-O-methylkaempferol
+
** 4689
−
* molecular weight:
+
* centisome position:
−
** 300.267    
+
** 38.07778    
 
* Synonym(s):
 
* Synonym(s):
−
** kaempferol 3-methyl ether
 
−
** 3-Methoxyapigenin
 
−
** isokaempferide
 
−
** 3-methylkaempferol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.7.1.148-RXN]]
−
* [[RXN-13935]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[NONMEVIPP-PWY]]
 +
* [[PWY-7560]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2389}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4689}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579]
+
{{#set: centisome position=38.07778   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.7.1.148-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902]
+
{{#set: pathway associated=NONMEVIPP-PWY|PWY-7560}}
−
{{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}}
+
−
{{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}}
+
−
{{#set: common name=3-O-methylkaempferol}}
+
−
{{#set: molecular weight=300.267   }}
+
−
{{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}}
+
−
{{#set: produced by=RXN-13935}}
+

Revision as of 00:08, 19 March 2018

Gene Tiso_gene_13463

  • left end position:
    • 2389
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4689
  • centisome position:
    • 38.07778
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15094&oldid=28849"