Difference between revisions of "CPD-8985"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_4992 == * Synonym(s): == Reactions associated == * CYTOCHROME-C-PEROXIDASE-RXN ** in-silico_annotation ***ec-number == Pathways associ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4992 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[CYTOCHROME-C-PEROXIDASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=CYTOCHROME-C-PEROXIDASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 01:09, 19 March 2018
Gene Tiso_gene_4992
- Synonym(s):
Reactions associated
- CYTOCHROME-C-PEROXIDASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation