Difference between revisions of "Tiso gene 646"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] == * smiles: ** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
(Created page with "Category:Gene == Gene Tiso_gene_17637 == * left end position: ** 2381 * transcription direction: ** NEGATIVE * right end position: ** 3472 * centisome position: ** 66.8257...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] ==
+
== Gene Tiso_gene_17637 ==
−
* smiles:
+
* left end position:
−
** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
+
** 2381
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** neolinustatin
+
** 3472
−
* molecular weight:
+
* centisome position:
−
** 423.416    
+
** 66.82570    
 
* Synonym(s):
 
* Synonym(s):
−
** butanenitrile
 
−
** [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13603]]
+
* [[PHOSPHORIBULOKINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[CALVIN-PWY]]
 +
* [[PWY-5723]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=2381}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08336 C08336]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3472}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7506 7506]
+
{{#set: centisome position=66.82570   }}
−
* PUBCHEM:
+
{{#set: reaction associated=PHOSPHORIBULOKINASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119533 119533]
+
{{#set: pathway associated=CALVIN-PWY|PWY-5723}}
−
* HMDB : HMDB38482
+
−
{{#set: smiles=CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N}}
+
−
{{#set: common name=neolinustatin}}
+
−
{{#set: molecular weight=423.416   }}
+
−
{{#set: common name=butanenitrile|[(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]}}
+
−
{{#set: consumed by=RXN-13603}}
+

Revision as of 00:13, 19 March 2018

Gene Tiso_gene_17637

  • left end position:
    • 2381
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3472
  • centisome position:
    • 66.82570
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_646&oldid=29239"