Difference between revisions of "Very-Long-Chain-Trans-23-Dehydroacyl-CoA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5282 RXN-5282] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5282 RXN-5282] ==
−
* smiles:
+
* direction:
−
** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L
+
−
* common name:
+
−
** nicotinate adenine dinucleotide
+
−
* molecular weight:
+
−
** 662.399   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Deamino-NAD+
 
−
** NaADN
 
−
** deamido-NAD+
 
−
** deamidonicotinamide adenine dinucleoetide
 
−
** deamido-NAD
 
−
** NAAD
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[DNNH]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[MG-PROTOPORPHYRIN-MONOMETHYL-ESTER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[13-HYDROXY-MAGNESIUM-PROTOPORP]][c] '''+''' 1 [[NADP]][c]
−
* [[NICONUCADENYLYLTRAN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 magnesium-protoporphyrin IX 13-monomethyl ester[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 1 H2O[c] '''+''' 1 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7159]], 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159]
 +
** '''8''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6450-77-7
+
* LIGAND-RXN:
−
* DRUGBANK : DB04099
+
** [http://www.genome.jp/dbget-bin/www_bget?R06265 R06265]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266646 45266646]
+
{{#set: in pathway=CHLOROPHYLL-SYN|PWY-7159}}
−
* HMDB : HMDB01179
+
{{#set: reconstruction category=manual}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=manual-primary_network}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00857 C00857]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58437 58437]
+
−
* BIGG : dnad
+
−
{{#set: smiles=C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L}}
+
−
{{#set: common name=nicotinate adenine dinucleotide}}
+
−
{{#set: molecular weight=662.399    }}
+
−
{{#set: common name=Deamino-NAD+|NaADN|deamido-NAD+|deamidonicotinamide adenine dinucleoetide|deamido-NAD|NAAD}}
+
−
{{#set: consumed by=DNNH}}
+
−
{{#set: produced by=NICONUCADENYLYLTRAN-RXN}}
+

Revision as of 00:16, 19 March 2018

Reaction RXN-5282

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • CHLOROPHYLL-SYN, 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): CHLOROPHYLL-SYN
    • 9 reactions found over 9 reactions in the full pathway
  • PWY-7159, 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): PWY-7159
    • 8 reactions found over 9 reactions in the full pathway

Reconstruction information

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Very-Long-Chain-Trans-23-Dehydroacyl-CoA&oldid=29528"