Difference between revisions of "RXN-15041"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=COA-PWY COA-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
 
* common name:
 
* common name:
−
** coenzyme A biosynthesis I
+
** 6-hydroxytyphasterol
 +
* molecular weight:
 +
** 450.701   
 
* Synonym(s):
 
* Synonym(s):
−
** CoA biosynthesis
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''4''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[DEPHOSPHOCOAKIN-RXN]]
+
* [[RXN-4241]]
−
* [[P-PANTOCYSDECARB-RXN]]
+
== Reaction(s) of unknown directionality ==
−
* [[P-PANTOCYSLIG-RXN]]
+
−
* [[PANTEPADENYLYLTRAN-RXN]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=COA-PWY COA-PWY]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372]
−
* ARACYC:
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=COA-PWY COA-PWY]
+
{{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}}
−
{{#set: taxonomic range=TAX-2759}}
+
{{#set: common name=6-hydroxytyphasterol}}
−
{{#set: taxonomic range=TAX-2157}}
+
{{#set: molecular weight=450.701    }}
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: produced by=RXN-4241}}
−
{{#set: common name=coenzyme A biosynthesis I}}
+
−
{{#set: common name=CoA biosynthesis}}
+
−
{{#set: reaction found=4}}
+
−
{{#set: reaction not found=4}}
+
−
{{#set: completion rate=100.0}}
+

Revision as of 18:21, 18 March 2018

Metabolite CPD-17420

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
  • common name:
    • 6-hydroxytyphasterol
  • molecular weight:
    • 450.701
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15041&oldid=23690"