Difference between revisions of "2-HYDROXYPHYTANOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aliphatic-Amines Aliphatic-Amines] == * common name: ** an aliphatic amine * Synonym(s): ** RCH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10337 CPD-10337] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10337 CPD-10337] == |
| + | * smiles: | ||
| + | ** C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
* common name: | * common name: | ||
| − | ** | + | ** chlorophyll c2 |
| + | * molecular weight: | ||
| + | ** 606.919 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-17487]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244281 25244281] |
| − | {{#set: consumed by= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38203 38203] | ||
| + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
| + | {{#set: common name=chlorophyll c2}} | ||
| + | {{#set: molecular weight=606.919 }} | ||
| + | {{#set: consumed or produced by=RXN-17487}} | ||
Revision as of 16:06, 10 January 2018
Contents
Metabolite CPD-10337
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- chlorophyll c2
- molecular weight:
- 606.919
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
