Difference between revisions of "Mannosyl8-Nacetylglucosaminyl2"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6146 PWY-6146] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] == * smiles: ** C(C(C(C(C(CO)O)O)O)=O)([O-])=O * common name: ** 2-keto-D-gluc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(C(C(C(C(CO)O)O)O)=O)([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** 2-keto-D-gluconate |
| + | * inchi key: | ||
| + | ** InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M | ||
| + | * molecular weight: | ||
| + | ** 193.133 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-dehydro-D-gluconate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[1.1.1.274-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06473 C06473] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5256721.html 5256721] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16808 16808] | ||
| + | * BIGG : 2dhglcn | ||
| + | * BIGG : 2dhguln | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857381 6857381] | ||
| + | {{#set: smiles=C(C(C(C(C(CO)O)O)O)=O)([O-])=O}} | ||
| + | {{#set: common name=2-keto-D-gluconate}} | ||
| + | {{#set: inchi key=InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M}} | ||
| + | {{#set: molecular weight=193.133 }} | ||
| + | {{#set: common name=2-dehydro-D-gluconate}} | ||
| + | {{#set: reversible reaction associated=1.1.1.274-RXN}} | ||
Revision as of 14:51, 21 March 2018
Contents
Metabolite CPD-377
- smiles:
- C(C(C(C(C(CO)O)O)O)=O)([O-])=O
- common name:
- 2-keto-D-gluconate
- inchi key:
- InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M
- molecular weight:
- 193.133
- Synonym(s):
- 2-dehydro-D-gluconate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(C(C(C(CO)O)O)O)=O)([O-])=O" cannot be used as a page name in this wiki.
