Difference between revisions of "16S-rRNA-cytidine1402"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-634 CPD-634] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17864 RXN-17864] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-634 CPD-634] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17864 RXN-17864] ==
* smiles:
+
* direction:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N
+
** [http://enzyme.expasy.org/EC/2.3.1.bu EC-2.3.1.bu]
* common name:
+
** castasterone
+
* molecular weight:
+
** 464.684   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-779]]
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[Protein-N-terminal-L-threonine]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Protein-N-terminal-N-Ac-L-threonine]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 acetyl-CoA[c] '''+''' 1 an N-terminal L-threonyl-[protein][c] '''=>''' 1 coenzyme A[c] '''+''' 1 H+[c] '''+''' 1 an N-terminal Nα-acetyl-L-threonyl-[protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=133534 133534]
+
{{#set: ec number=EC-2.3.1.bu}}
* CHEBI:
+
{{#set: in pathway=PWY-7800}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23051 23051]
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C15794 C15794]
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N}}
+
{{#set: common name=castasterone}}
+
{{#set: molecular weight=464.684    }}
+
{{#set: produced by=RXN-779}}
+

Revision as of 14:53, 21 March 2018

Reaction RXN-17864

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7800, Ac/N-end rule pathway: PWY-7800
    • 21 reactions found over 21 reactions in the full pathway

Reconstruction information

External links