Difference between revisions of "ALCDHi"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dTDP-L-olivose biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''7''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_7329]] | ||
| + | *** [[Tiso_gene_12394]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[DTDPGLUCOSEPP-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_14704]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-synechocystis]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12404 RXN-12404] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12928 RXN-12928] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12929 RXN-12929] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12943 RXN-12943] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16262 RXN-16262] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=dTDP-L-olivose biosynthesis}} | |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | + | {{#set: total reaction=7}} | |
| − | {{#set: common name= | + | {{#set: completion rate=29.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 14:53, 21 March 2018
Pathway PWY-6974
- taxonomic range:
- common name:
- dTDP-L-olivose biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 7 reactions in the full pathway
- DTDPGLUCDEHYDRAT-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- DTDPGLUCOSEPP-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
