Difference between revisions of "PWY-7416"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == * smiles: ** C([O-])(=O)CCCC(C(=O)[O-])[N+] * inchi key: ** InChIKey=OYIFNH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6963 PWY-6963] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2836 TAX-28...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6963 PWY-6963] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2836 TAX-2836] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* common name: | * common name: | ||
− | ** | + | ** ammonia assimilation cycle I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GS/GOGAT pathway |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''4''' reactions found over '''6''' reactions in the full pathway | |
− | * [[ | + | * [[GLNSYN-PWY]] |
− | * [[ | + | ** 0 associated gene: |
− | * [[ | + | * [[GLUGLNSYN-PWY]] |
− | + | ** 0 associated gene: | |
− | * [[ | + | * [[GLUTAMATE-SYNTHASE-NADH-RXN]] |
− | * [[ | + | ** 3 associated gene(s): |
+ | *** [[Tiso_gene_11511]] | ||
+ | *** [[Tiso_gene_1154]] | ||
+ | *** [[Tiso_gene_2581]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[manual-primary_network]] | ||
+ | * [[GLUTAMINESYN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_14842]] | ||
+ | *** [[Tiso_gene_13754]] | ||
+ | *** [[Tiso_gene_13820]] | ||
+ | *** [[Tiso_gene_6647]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2836}} | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=ammonia assimilation cycle I}} | |
− | + | {{#set: common name=GS/GOGAT pathway}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:59, 21 March 2018
Pathway PWY-6963
- taxonomic range:
- common name:
- ammonia assimilation cycle I
- Synonym(s):
- GS/GOGAT pathway
Reaction(s) found
4 reactions found over 6 reactions in the full pathway
- GLNSYN-PWY
- 0 associated gene:
- GLUGLNSYN-PWY
- 0 associated gene:
- GLUTAMATE-SYNTHASE-NADH-RXN
- 3 associated gene(s):
- 5 reconstruction source(s) associated:
- GLUTAMINESYN-RXN
- 4 associated gene(s):
- 6 reconstruction source(s) associated: