Difference between revisions of "Cis-cis-D19-37-C56-2-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3080 == * left end position: ** 20 * transcription direction: ** POSITIVE * right end position: ** 7065 * centisome position: ** 0.10166734...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
+
== Gene Tiso_gene_3080 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 20
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2E,7Z)-hexadecenoyl-CoA
+
** 7065
−
* molecular weight:
+
* centisome position:
−
** 997.883    
+
** 0.10166734    
 
* Synonym(s):
 
* Synonym(s):
−
** 16:2-Δ2,Δ7-CoA
 
−
** 2-trans,7-cis-hexadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-15556]]
−
* [[RXN-17779]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=20}}
−
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=7065}}
−
{{#set: molecular weight=997.883   }}
+
{{#set: centisome position=0.10166734   }}
−
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: produced by=RXN-17779}}
+
{{#set: pathway associated=PWY-7511}}

Revision as of 16:09, 10 January 2018

Gene Tiso_gene_3080

  • left end position:
    • 20
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7065
  • centisome position:
    • 0.10166734
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-cis-D19-37-C56-2-ACPs&oldid=11766"