Difference between revisions of "S-Substituted-Glutathione"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DISSULFRED-PWY DISSULFRED-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=DISSULFRED-PWY DISSULFRED-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
−
** sulfate reduction IV (dissimilatory, to hydrogen sufide))
+
** 6-hydroxytyphasterol
 +
* inchi key:
 +
** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
 +
* molecular weight:
 +
** 450.701   
 
* Synonym(s):
 
* Synonym(s):
−
** sulfate respiration
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[SULFATE-ADENYLYLTRANS-RXN]]
+
* [[RXN-4241]]
−
** 2 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_10254]]
+
−
*** [[Tiso_gene_17879]]
+
−
** 5 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[manual-primary_network]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=ADENYLYLSULFATE-REDUCTASE-RXN ADENYLYLSULFATE-REDUCTASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17803 RXN-17803]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17804 RXN-17804]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2157}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372]
−
{{#set: common name=sulfate reduction IV (dissimilatory, to hydrogen sufide))}}
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: common name=sulfate respiration}}
+
{{#set: common name=6-hydroxytyphasterol}}
−
{{#set: reaction found=1}}
+
{{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}}
−
{{#set: total reaction=4}}
+
{{#set: molecular weight=450.701    }}
−
{{#set: completion rate=25.0}}
+
{{#set: produced by=RXN-4241}}

Revision as of 15:16, 21 March 2018

Metabolite CPD-17420

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6-hydroxytyphasterol
  • inchi key:
    • InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
  • molecular weight:
    • 450.701
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=S-Substituted-Glutathione&oldid=33276"