Difference between revisions of "Tiso gene 16927"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3981 PWY-3981] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3981 PWY-3981] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
+
 
* common name:
 
* common name:
−
** (2E,7Z)-tetradecenoyl-CoA
+
** β-alanine biosynthesis I
−
* molecular weight:
+
−
** 969.83   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 14:2-Δ2,Δ7-CoA
+
** β-alanine biosynthesis from polyamines
−
** 2-trans,7-cis-tetradecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-17793]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-6381]]
−
* [[RXN-17792]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_8756]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-6382]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3513]]
 +
*** [[Tiso_gene_7322]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ARACYC:
−
{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3981 PWY-3981]
−
{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: molecular weight=969.83    }}
+
{{#set: common name=β-alanine biosynthesis I}}
−
{{#set: common name=14:2-Δ2,Δ7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
+
{{#set: common name=β-alanine biosynthesis from polyamines}}
−
{{#set: consumed by=RXN-17793}}
+
{{#set: reaction found=2}}
−
{{#set: produced by=RXN-17792}}
+
{{#set: total reaction=2}}
 +
{{#set: completion rate=100.0}}

Revision as of 16:20, 21 March 2018

Pathway PWY-3981

  • taxonomic range:
  • common name:
    • β-alanine biosynthesis I
  • Synonym(s):
    • β-alanine biosynthesis from polyamines

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16927&oldid=33651"