Difference between revisions of "16S-rRNA-N2-methylguanine966"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** nicotine-glucuronide |
+ | * inchi key: | ||
+ | ** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 339.367 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-83]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524] |
− | * | + | * HMDB : HMDB01272 |
− | + | {{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}} | |
− | {{#set: smiles= | + | {{#set: common name=nicotine-glucuronide}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}} |
− | {{#set: | + | {{#set: molecular weight=339.367 }} |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN66-83}} |
− | + | ||
− | + | ||
− | {{#set: produced by= | + |
Revision as of 15:23, 21 March 2018
Contents
Metabolite CPD-2744
- smiles:
- C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
- common name:
- nicotine-glucuronide
- inchi key:
- InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
- molecular weight:
- 339.367
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01272
"C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.