Difference between revisions of "Tiso gene 4147"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * common name: ** histidinol * inc...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
+
** C1(NC=NC=1CC(CO)[N+])
 
* common name:
 
* common name:
−
** L-citrulline biosynthesis
+
** histidinol
 +
* inchi key:
 +
** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
 +
* molecular weight:
 +
** 142.18   
 
* Synonym(s):
 
* Synonym(s):
 +
** histidol
 +
** L-histidinol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''8''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-8001]]
−
* [[ARGINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
* [[HISTIDPHOS-RXN]]
−
*** [[Tiso_gene_4415]]
+
== Reaction(s) of unknown directionality ==
−
** 4 reconstruction source(s) associated:
+
* [[HISTOLDEHYD-RXN]]
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[GLUTAMIN-RXN]]
+
−
** 15 associated gene(s):
+
−
*** [[Tiso_gene_1154]]
+
−
*** [[Tiso_gene_3434]]
+
−
*** [[Tiso_gene_17333]]
+
−
*** [[Tiso_gene_4976]]
+
−
*** [[Tiso_gene_2973]]
+
−
*** [[Tiso_gene_3435]]
+
−
*** [[Tiso_gene_4685]]
+
−
*** [[Tiso_gene_2581]]
+
−
*** [[Tiso_gene_11511]]
+
−
*** [[Tiso_gene_17058]]
+
−
*** [[Tiso_gene_7495]]
+
−
*** [[Tiso_gene_19661]]
+
−
*** [[Tiso_gene_6657]]
+
−
*** [[Tiso_gene_1773]]
+
−
*** [[Tiso_gene_4975]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[GLUTKIN-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Tiso_gene_12021]]
+
−
*** [[Tiso_gene_16634]]
+
−
*** [[Tiso_gene_17057]]
+
−
** 7 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[GLUTSEMIALDEHYDROG-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_16634]]
+
−
*** [[Tiso_gene_16258]]
+
−
** 6 reconstruction source(s) associated:
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[ORNCARBAMTRANSFER-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_18444]]
+
−
** 7 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_11231]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-synechocystis]]
+
−
* [[RXN-14903]]
+
−
** 3 associated gene(s):
+
−
*** [[Tiso_gene_18826]]
+
−
*** [[Tiso_gene_9762]]
+
−
*** [[Tiso_gene_18825]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[SPONTPRO-RXN]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-40674}}
+
* CAS : 501-28-0
−
{{#set: common name=L-citrulline biosynthesis}}
+
* PUBCHEM:
−
{{#set: reaction found=8}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298]
−
{{#set: total reaction=8}}
+
* KNAPSACK : C00007479
−
{{#set: completion rate=100.0}}
+
* HMDB : HMDB03431
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699]
 +
* BIGG : histd
 +
{{#set: smiles=C1(NC=NC=1CC(CO)[N+])}}
 +
{{#set: common name=histidinol}}
 +
{{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}}
 +
{{#set: molecular weight=142.18    }}
 +
{{#set: common name=histidol|L-histidinol}}
 +
{{#set: consumed by=RXN-8001}}
 +
{{#set: produced by=HISTIDPHOS-RXN}}
 +
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}}

Revision as of 16:24, 21 March 2018

Metabolite HISTIDINOL

  • smiles:
    • C1(NC=NC=1CC(CO)[N+])
  • common name:
    • histidinol
  • inchi key:
    • InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
  • molecular weight:
    • 142.18
  • Synonym(s):
    • histidol
    • L-histidinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 501-28-0
  • PUBCHEM:
  • KNAPSACK : C00007479
  • HMDB : HMDB03431
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : histd
"C1(NC=NC=1CC(CO)[N+])" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4147&oldid=34010"