Difference between revisions of "L-methionyl-L-asparaginyl-Protein"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * smiles: ** CC(CC([N+])C([O-])=O)C * inchi key: ** InChIKey=ROHFNLRQFUQHCH-YFKPBYR...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * common name: ** le...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == |
* smiles: | * smiles: | ||
− | ** | + | ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** leucodopachrome |
+ | * inchi key: | ||
+ | ** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 194.166 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cyclo-dopa |
− | + | ** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole | |
− | + | ||
− | + | ||
− | ** 2- | + | |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11369]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8483]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233] |
− | * HMDB : | + | * HMDB : HMDB04067 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604] |
− | + | {{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}} | |
− | + | {{#set: common name=leucodopachrome}} | |
− | + | {{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=194.166 }} |
− | {{#set: | + | {{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}} |
− | {{#set: | + | {{#set: consumed by=RXN-11369}} |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN-8483}} |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | {{#set: | + |
Revision as of 15:25, 21 March 2018
Contents
Metabolite CPD-8652
- smiles:
- C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
- common name:
- leucodopachrome
- inchi key:
- InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
- molecular weight:
- 194.166
- Synonym(s):
- cyclo-dopa
- 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))" cannot be used as a page name in this wiki.