Difference between revisions of "PWY-7347"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=YB...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_Light TransportSeed_Light] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reactio...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_Light TransportSeed_Light] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1.0 [[Light]][e] '''=>''' 1.0 [[Light]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1.0 hν[e] '''=>''' 1.0 hν[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[manual]] | ||
| + | ** Source: [[manual-import_from_medium]] | ||
| + | *** Comment: [[added to manage seeds from extracellular to cytosol compartment]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=}} | |
| − | {{#set: | + | {{#set: reconstruction category=manual}} |
| − | {{#set: | + | {{#set: reconstruction source=manual-import_from_medium}} |
| − | {{#set: | + | {{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}} |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:27, 21 March 2018
Contents
Reaction TransportSeed_Light
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
Genes associated with this reaction
Pathways
Reconstruction information
- Category: manual
