Difference between revisions of "N-Acylated-Aliphatic-Amino-Acids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * smiles: ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=...")
(Created page with "Category:Gene == Gene Tiso_gene_9472 == * right end position: ** 8940 * transcription direction: ** POSITIVE * left end position: ** 6601 * centisome position: ** 70.85659...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] ==
+
== Gene Tiso_gene_9472 ==
−
* smiles:
+
* right end position:
−
** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
** 8940
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (2E,11Z)-hexadec-2,11-dienoyl-CoA
+
** 6601
−
* molecular weight:
+
* centisome position:
−
** 997.883    
+
** 70.85659    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15684]]
−
* [[RXN-16557]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[THIOL-OXIDASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=8940}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819958 91819958]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
{{#set: left end position=6601}}
−
{{#set: inchi key=InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J}}
+
{{#set: centisome position=70.85659    }}
−
{{#set: common name=(2E,11Z)-hexadec-2,11-dienoyl-CoA}}
+
{{#set: reaction associated=RXN-15684|THIOL-OXIDASE-RXN}}
−
{{#set: molecular weight=997.883    }}
+
{{#set: pathway associated=PWY-7533}}
−
{{#set: produced by=RXN-16557}}
+

Revision as of 15:29, 21 March 2018

Gene Tiso_gene_9472

  • right end position:
    • 8940
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6601
  • centisome position:
    • 70.85659
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-Acylated-Aliphatic-Amino-Acids&oldid=34420"