Difference between revisions of "RXN-15635"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] == * smiles: ** C(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5055 RXN0-5055] == * direction: ** LEFT-TO-RIGHT * common name: ** Acetyl-CoA carboxylase 2 **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5055 RXN0-5055] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K
+
 
* common name:
 
* common name:
−
** 3-deoxy-D-arabino-heptulosonate 7-phosphate
+
** Acetyl-CoA carboxylase 2
−
* molecular weight:
+
** Acetyl-CoA carboxylase 1
−
** 285.124   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.4.1.2 EC-6.4.1.2]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-deoxy-D-arabino-heptulosonate-7-P
 
−
** 3-deoxy-arabino-heptulosonate 7-phosphate
 
−
** 3-deoxy-arabino-heptulosonate-7-P
 
−
** 2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
 
−
** 3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate
 
−
** 3-deoxy-arabino-heptulonate 7-phosphate
 
−
** DAHP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[ACETYL-COA]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Carboxybiotin-BCCP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[BCCP-dimers]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[MALONYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[DAHPSYN-RXN]]
+
** 1 ATP[c] '''+''' 1 acetyl-CoA[c] '''+''' 1 H2O[c] '''+''' 1 a carboxylated-biotinylated [BCCP dimer][c] '''=>''' 1 H+[c] '''+''' 1 phosphate[c] '''+''' 1 a biotinylated [BCCP dimer][c] '''+''' 1 ADP[c] '''+''' 1 malonyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7965]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_3800]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY0-1264]], biotin-carboxyl carrier protein assembly: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2627-73-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Acetyl-CoA carboxylase 2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460215 5460215]
+
{{#set: common name=Acetyl-CoA carboxylase 1}}
−
* CHEBI:
+
{{#set: ec number=EC-6.4.1.2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58394 58394]
+
{{#set: gene associated=Tiso_gene_7965|Tiso_gene_3800}}
−
* BIGG : 2dda7p
+
{{#set: in pathway=PWY0-1264}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04691 C04691]
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus}}
−
{{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-]}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: inchi key=InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K}}
+
−
{{#set: common name=3-deoxy-D-arabino-heptulosonate 7-phosphate}}
+
−
{{#set: molecular weight=285.124    }}
+
−
{{#set: common name=3-deoxy-D-arabino-heptulosonate-7-P|3-deoxy-arabino-heptulosonate 7-phosphate|3-deoxy-arabino-heptulosonate-7-P|2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate|3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate|3-deoxy-arabino-heptulonate 7-phosphate|DAHP}}
+
−
{{#set: consumed by=3-DEHYDROQUINATE-SYNTHASE-RXN}}
+
−
{{#set: reversible reaction associated=DAHPSYN-RXN}}
+

Revision as of 15:31, 21 March 2018

Reaction RXN0-5055

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Acetyl-CoA carboxylase 2
    • Acetyl-CoA carboxylase 1
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 acetyl-CoA[c] + 1 H2O[c] + 1 a carboxylated-biotinylated [BCCP dimer][c] => 1 H+[c] + 1 phosphate[c] + 1 a biotinylated [BCCP dimer][c] + 1 ADP[c] + 1 malonyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1264, biotin-carboxyl carrier protein assembly: PWY0-1264
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15635&oldid=34619"