Difference between revisions of "FNorh"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
(Created page with "Category:Gene == Gene Tiso_gene_14633 == * right end position: ** 5478 * transcription direction: ** NEGATIVE * left end position: ** 3946 * centisome position: ** 71.4078...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14633 == |
− | * | + | * right end position: |
− | ** | + | ** 5478 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 3946 |
− | * | + | * centisome position: |
− | ** | + | ** 71.40789 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[G6PI]] |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | + | * Reaction: [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5478}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=3946}} | |
− | + | {{#set: centisome position=71.40789 }} | |
− | + | {{#set: reaction associated=G6PI|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 16:31, 21 March 2018
Gene Tiso_gene_14633
- right end position:
- 5478
- transcription direction:
- NEGATIVE
- left end position:
- 3946
- centisome position:
- 71.40789
- Synonym(s):
Reactions associated
- Reaction: G6PI
- Source: orthology-creinhardtii
- Reaction: GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation