Difference between revisions of "Tiso gene 3775"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key: ** InChIKey=QIVB...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3beta-hydroxy-4alpha-carboxy-sterols 3beta-hydroxy-4alpha-carboxy-sterols] == * common name: **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3beta-hydroxy-4alpha-carboxy-sterols 3beta-hydroxy-4alpha-carboxy-sterols] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 3β-hydroxy-4α-carboxysteroid |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a 3β-hydroxysteroid-4α-carboxylate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-13926]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a 3β-hydroxy-4α-carboxysteroid}} | |
− | + | {{#set: common name=a 3β-hydroxysteroid-4α-carboxylate}} | |
− | + | {{#set: consumed or produced by=RXN-13926}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed | + | |
− | + |
Revision as of 16:13, 10 January 2018
Contents
Metabolite 3beta-hydroxy-4alpha-carboxy-sterols
- common name:
- a 3β-hydroxy-4α-carboxysteroid
- Synonym(s):
- a 3β-hydroxysteroid-4α-carboxylate