Difference between revisions of "Tiso gene 6606"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1799 == * Synonym(s): == Reactions associated == * DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN ** pantograph-athaliana ** [[pantograph]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * common name: ** S-methyl-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == |
+ | * smiles: | ||
+ | ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) | ||
+ | * common name: | ||
+ | ** S-methyl-5-thio-α-D-ribose 1-phosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L | ||
+ | * molecular weight: | ||
+ | ** 258.182 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-methylthioribose-1-phosphate | ||
+ | ** S5-methyl-5-thio-D-ribose-1-phosphate | ||
+ | ** 5-methylthio-D-ribose-1-phosphate | ||
+ | ** 5-MTR-1-P | ||
+ | ** 1-phosphomethylthioribose | ||
+ | ** 1-phospho-5-S-methylthioribose | ||
+ | ** 1-PMTR | ||
+ | ** 1-phospho-5-S-methylthio-α-D-ribofuranoside | ||
+ | ** S-methyl-5-thio-α-D-ribose 1-phosphate | ||
+ | ** S-methyl-5-thio-D-ribose 1-phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[M5TRPI]] |
− | + | * [[5.3.1.23-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[M5TAP]] |
− | + | * [[M5TRK]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 5mdr1p |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266677 45266677] | ||
+ | * HMDB : HMDB00963 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04188 C04188] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58533 58533] | ||
+ | * METABOLIGHTS : MTBLC58533 | ||
+ | {{#set: smiles=CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)}} | ||
+ | {{#set: common name=S-methyl-5-thio-α-D-ribose 1-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L}} | ||
+ | {{#set: molecular weight=258.182 }} | ||
+ | {{#set: common name=5-methylthioribose-1-phosphate|S5-methyl-5-thio-D-ribose-1-phosphate|5-methylthio-D-ribose-1-phosphate|5-MTR-1-P|1-phosphomethylthioribose|1-phospho-5-S-methylthioribose|1-PMTR|1-phospho-5-S-methylthio-α-D-ribofuranoside|S-methyl-5-thio-α-D-ribose 1-phosphate|S-methyl-5-thio-D-ribose 1-phosphate}} | ||
+ | {{#set: consumed by=M5TRPI|5.3.1.23-RXN}} | ||
+ | {{#set: produced by=M5TAP|M5TRK}} |
Revision as of 15:33, 21 March 2018
Contents
Metabolite CPD-444
- smiles:
- CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)
- common name:
- S-methyl-5-thio-α-D-ribose 1-phosphate
- inchi key:
- InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L
- molecular weight:
- 258.182
- Synonym(s):
- 5-methylthioribose-1-phosphate
- S5-methyl-5-thio-D-ribose-1-phosphate
- 5-methylthio-D-ribose-1-phosphate
- 5-MTR-1-P
- 1-phosphomethylthioribose
- 1-phospho-5-S-methylthioribose
- 1-PMTR
- 1-phospho-5-S-methylthio-α-D-ribofuranoside
- S-methyl-5-thio-α-D-ribose 1-phosphate
- S-methyl-5-thio-D-ribose 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 5mdr1p
- PUBCHEM:
- HMDB : HMDB00963
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58533
"CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)" cannot be used as a page name in this wiki.