Difference between revisions of "CPD-15368"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6882 == * Synonym(s): == Reactions associated == * GCVT-RXN ** pantograph-esiliculosus == Pathways associated == * GLYCLEAV-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE L-RIBULOSE] == * smiles: ** C(O)C(O)C(O)C(=O)CO * common name: ** L-ribulose * inchi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE L-RIBULOSE] == |
+ | * smiles: | ||
+ | ** C(O)C(O)C(O)C(=O)CO | ||
+ | * common name: | ||
+ | ** L-ribulose | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZAQJHHRNXZUBTE-UCORVYFPSA-N | ||
+ | * molecular weight: | ||
+ | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ribulose | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-5116]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 488-84-6 |
− | {{#set: | + | * CAS : 2042-27-5 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644111 644111] | ||
+ | * HMDB : HMDB03371 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00508 C00508] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.559151.html 559151] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16880 16880] | ||
+ | * BIGG : rbl__L | ||
+ | {{#set: smiles=C(O)C(O)C(O)C(=O)CO}} | ||
+ | {{#set: common name=L-ribulose}} | ||
+ | {{#set: inchi key=InChIKey=ZAQJHHRNXZUBTE-UCORVYFPSA-N}} | ||
+ | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: common name=ribulose}} | ||
+ | {{#set: consumed by=RXN0-5116}} |
Revision as of 15:34, 21 March 2018
Contents
Metabolite L-RIBULOSE
- smiles:
- C(O)C(O)C(O)C(=O)CO
- common name:
- L-ribulose
- inchi key:
- InChIKey=ZAQJHHRNXZUBTE-UCORVYFPSA-N
- molecular weight:
- 150.131
- Synonym(s):
- ribulose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 488-84-6
- CAS : 2042-27-5
- PUBCHEM:
- HMDB : HMDB03371
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : rbl__L