Difference between revisions of "CPD-13533"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == * smiles: ** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * common name...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate |
| + | * inchi key: | ||
| + | ** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 334.43 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13677]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346] |
| − | {{#set: smiles= | + | {{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}} |
| − | {{#set: | + | {{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=334.43 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-13677}} |
| − | + | ||
Revision as of 15:36, 21 March 2018
Contents
Metabolite CPD-14705
- smiles:
- CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
- common name:
- 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
- inchi key:
- InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
- molecular weight:
- 334.43
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.
"4-hydroxy-2-nonenal-[Cys-Gly] conjugate" cannot be used as a page name in this wiki.
