Difference between revisions of "ACCOAtm"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntF Holo-EntF] == * common name: ** a holo-[EntF peptidyl-carrier protein] * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** aldehy...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] == |
+ | * smiles: | ||
+ | ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** aldehydo-D-galacturonate |
+ | * inchi key: | ||
+ | ** InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M | ||
+ | * molecular weight: | ||
+ | ** 193.133 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[GALACTUROISOM-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1593918 1593918] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12952 12952] | ||
+ | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | ||
+ | {{#set: common name=aldehydo-D-galacturonate}} | ||
+ | {{#set: inchi key=InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M}} | ||
+ | {{#set: molecular weight=193.133 }} | ||
+ | {{#set: reversible reaction associated=GALACTUROISOM-RXN}} |
Revision as of 15:39, 21 March 2018
Contents
Metabolite CPD-15633
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
- common name:
- aldehydo-D-galacturonate
- inchi key:
- InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M
- molecular weight:
- 193.133
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.