Difference between revisions of "N-FORMYLMETHIONINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == * smiles: ** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Gene == Gene Tiso_gene_17237 == * right end position: ** 3684 * transcription direction: ** POSITIVE * left end position: ** 74 * centisome position: ** 1.92859...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] ==
+
== Gene Tiso_gene_17237 ==
* smiles:
+
* right end position:
** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3684
* inchi key:
+
* transcription direction:
** InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J
+
** POSITIVE
* common name:
+
* left end position:
** 5-cis, 7-trans-tetradecadienoyl-CoA
+
** 74
* molecular weight:
+
* centisome position:
** 969.83    
+
** 1.92859    
 
* Synonym(s):
 
* Synonym(s):
** 5Z, 7E-tetradecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14796]]
+
* Reaction: [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-12445]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=3684}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659270 90659270]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=74}}
{{#set: inchi key=InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J}}
+
{{#set: centisome position=1.92859   }}
{{#set: common name=5-cis, 7-trans-tetradecadienoyl-CoA}}
+
{{#set: reaction associated=NADPH-DEHYDROGENASE-FLAVIN-RXN|RXN-12445}}
{{#set: molecular weight=969.83   }}
+
{{#set: common name=5Z, 7E-tetradecadienoyl-CoA}}
+
{{#set: consumed by=RXN-14796}}
+

Revision as of 15:52, 21 March 2018

Gene Tiso_gene_17237

  • right end position:
    • 3684
  • transcription direction:
    • POSITIVE
  • left end position:
    • 74
  • centisome position:
    • 1.92859
  • Synonym(s):

Reactions associated

Pathways associated

External links