Difference between revisions of "CPD-14426"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * smiles: ** C(NC(N)=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6321 RXN-6321] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6321 RXN-6321] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[WATER]][c] '''+''' 1 [[5-10-METHENYL-THF-GLU-N]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[N5-Formyl-THF-Glu-N]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 a 5,10-methenyltetrahydrofolate[c] '''=>''' 1 H+[c] '''+''' 1 an (6S)-N5-formyl-tetrahydrofolate[c] |
| − | * [[ | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_17287]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841] | ||
| + | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34767 34767] | |
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02300 R02300] | |
| − | ** [http:// | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: gene associated=Tiso_gene_17287}} | |
| − | * LIGAND- | + | {{#set: in pathway=PWY-3841}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:52, 21 March 2018
Contents
Reaction RXN-6321
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 5-10-METHENYL-THF-GLU-N[c] => 1 PROTON[c] + 1 N5-Formyl-THF-Glu-N[c]
- With common name(s):
- 1 H2O[c] + 1 a 5,10-methenyltetrahydrofolate[c] => 1 H+[c] + 1 an (6S)-N5-formyl-tetrahydrofolate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17287
- Source: orthology-esiliculosus
Pathways
- PWY-3841, folate transformations II: PWY-3841
- 9 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
