Difference between revisions of "GTUP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-460 RXN1G-460] == * direction: ** REVERSIBLE * common name: ** 3-oxoacyl-synthase * ec number...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-460 RXN1G-460] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxoacyl-synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[PROTON]][c] '''+''' 1 [[CPD-9965]][c] '''+''' 1 [[MALONYL-ACP]][c] '''<=>''' 1 [[3-oxo-behenoyl-ACPs]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H+[c] '''+''' 1 icosanoyl-CoA[c] '''+''' 1 a malonyl-[acp][c] '''<=>''' 1 a 3-oxo-behenoyl-[acp][c] '''+''' 1 coenzyme A[c] '''+''' 1 CO2[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_5939]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | * [[Tiso_gene_14485]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_15991]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_19302]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[esiliculosus]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[experimental_annotation]] | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=3-oxoacyl-synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.41}} | |
− | + | {{#set: gene associated=Tiso_gene_5939|Tiso_gene_14485|Tiso_gene_15991|Tiso_gene_19302}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:16, 10 January 2018
Contents
Reaction RXN1G-460
- direction:
- REVERSIBLE
- common name:
- 3-oxoacyl-synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 CPD-9965[c] + 1 MALONYL-ACP[c] <=> 1 3-oxo-behenoyl-ACPs[c] + 1 CO-A[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 H+[c] + 1 icosanoyl-CoA[c] + 1 a malonyl-[acp][c] <=> 1 a 3-oxo-behenoyl-[acp][c] + 1 coenzyme A[c] + 1 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_5939
- IN-SILICO_ANNOTATION
- EC-NUMBER
- EXPERIMENTAL_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION
- Tiso_gene_14485
- Tiso_gene_15991
- Tiso_gene_19302