Difference between revisions of "PRADP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_4174 == * right end position: ** 1474 * transcription direction: ** POSITIVE * left end position: ** 1026 * centisome position: ** 5.325996...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4174 == |
− | * | + | * right end position: |
− | ** | + | ** 1474 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1026 |
− | * | + | * centisome position: |
− | ** | + | ** 5.3259964 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[TYROSINE--TRNA-LIGASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[TRNA-CHARGING-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1474}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1026}} | |
− | + | {{#set: centisome position=5.3259964 }} | |
− | + | {{#set: reaction associated=TYROSINE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:53, 21 March 2018
Gene Tiso_gene_4174
- right end position:
- 1474
- transcription direction:
- POSITIVE
- left end position:
- 1026
- centisome position:
- 5.3259964
- Synonym(s):
Reactions associated
- Reaction: TYROSINE--TRNA-LIGASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation