Difference between revisions of "HYDRPHENYLAC-CPD"

Revision as of 15:54, 21 March 2018

"a 3-oxo-hexanoyl-[acp" cannot be used as a page name in this wiki.

"a 3-oxo-hexanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-hexanoyl-ACPs 3-oxo-hexanoyl-ACPs] ==
-* smiles:
-** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
-* inchi key:
-** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
 * common name:
-** indoxyl sulfate
+** a 3-oxo-hexanoyl-[acp]
-* molecular weight:
-** 212.2
 * Synonym(s):
-** indol-3-yl sulfate
+** a 3-oxo-hexanoyl-[acyl-carrier protein]
 == Reaction(s) known to consume the compound ==
+* [[RXN-9518]]
+* [[RXN-14972]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-9648]]
+* [[RXN-9516]]
 == Reaction(s) of unknown directionality ==
-* [[RXN-15587]]
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a 3-oxo-hexanoyl-[acp]}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098]
+{{#set: common name=a 3-oxo-hexanoyl-[acyl-carrier protein]}}
-* CHEBI:
+{{#set: consumed by=RXN-9518|RXN-14972}}
-** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355]
+{{#set: produced by=RXN-9648|RXN-9516}}
-* HMDB : HMDB00682
-{{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}}
-{{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}}
-{{#set: common name=indoxyl sulfate}}
-{{#set: molecular weight=212.2    }}
-{{#set: common name=indol-3-yl sulfate}}
-{{#set: reversible reaction associated=RXN-15587}}