Difference between revisions of "PYAMPP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
(Created page with "Category:Gene == Gene Tiso_gene_10649 == * right end position: ** 8387 * transcription direction: ** POSITIVE * left end position: ** 8215 * centisome position: ** 97.9492...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
+
== Gene Tiso_gene_10649 ==
* smiles:
+
* right end position:
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** 8387
* inchi key:
+
* transcription direction:
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
+
** POSITIVE
* common name:
+
* left end position:
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
+
** 8215
* molecular weight:
+
* centisome position:
** 412.698    
+
** 97.9492    
 
* Synonym(s):
 
* Synonym(s):
** 5α-cholesta-8,24-dien-3β-ol
 
** 4α,14α-dimethylzymosterol
 
** 29-norlanosterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-11881]]
+
* Reaction: [[3.1.26.3-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=8387}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15101557 15101557]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: left end position=8215}}
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
+
{{#set: centisome position=97.9492   }}
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: reaction associated=3.1.26.3-RXN}}
{{#set: molecular weight=412.698   }}
+
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}}
+
{{#set: consumed by=RXN-11881}}
+

Revision as of 15:56, 21 March 2018

Gene Tiso_gene_10649

  • right end position:
    • 8387
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8215
  • centisome position:
    • 97.9492
  • Synonym(s):

Reactions associated

Pathways associated

External links