Difference between revisions of "PWY-6902"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * common...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902] ==
−
* smiles:
+
* taxonomic range:
−
** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-976 TAX-976]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* common name:
 
* common name:
−
** 5-hydroxyisourate
+
** chitin degradation II (Vibrio)
−
* inchi key:
+
−
** InChIKey=LTQYPAVLAYVKTK-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 184.111   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[3.5.2.17-RXN]]
+
'''3''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[3.2.1.14-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_10265]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-12625]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_1129]]
 +
*** [[Tiso_gene_14122]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-12626]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_1129]]
 +
*** [[Tiso_gene_14122]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12623 RXN-12623]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-323 TRANS-RXN-323]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=250388 250388]
+
{{#set: taxonomic range=TAX-33154}}
−
* HMDB : HMDB30097
+
{{#set: taxonomic range=TAX-1239}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-201174}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11821 C11821]
+
{{#set: taxonomic range=TAX-976}}
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-1224}}
−
** [http://www.chemspider.com/Chemical-Structure.219288.html 219288]
+
{{#set: common name=chitin degradation II (Vibrio)}}
−
* CHEBI:
+
{{#set: reaction found=3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18072 18072]
+
{{#set: total reaction=5}}
−
* METABOLIGHTS : MTBLC18072
+
{{#set: completion rate=60.0}}
−
{{#set: smiles=C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O)}}
+
−
{{#set: common name=5-hydroxyisourate}}
+
−
{{#set: inchi key=InChIKey=LTQYPAVLAYVKTK-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=184.111    }}
+
−
{{#set: consumed by=3.5.2.17-RXN}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY-6902

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6902&oldid=39489"