Difference between revisions of "Tiso gene 727"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * com...") |
(Created page with "Category:Gene == Gene Tiso_gene_727 == * right end position: ** 2262 * transcription direction: ** POSITIVE * left end position: ** 97 * centisome position: ** 0.33425224...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_727 == |
− | * | + | * right end position: |
− | ** | + | ** 2262 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 97 |
− | * | + | * centisome position: |
− | ** | + | ** 0.33425224 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.5.1.98-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2262}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=97}} | |
− | + | {{#set: centisome position=0.33425224 }} | |
− | + | {{#set: reaction associated=3.5.1.98-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:08, 21 March 2018
Gene Tiso_gene_727
- right end position:
- 2262
- transcription direction:
- POSITIVE
- left end position:
- 97
- centisome position:
- 0.33425224
- Synonym(s):
Reactions associated
- Reaction: 3.5.1.98-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation