Difference between revisions of "PWY-5805"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8949 == * left end position: ** 1009 * transcription direction: ** POSITIVE * right end position: ** 9719 * centisome position: ** 10.35615...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] == * smiles:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N |
| − | * | + | * common name: |
| − | ** | + | ** 4α-methyl-5α-cholest-7-en-3-one |
| − | * | + | * molecular weight: |
| − | ** | + | ** 398.671 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[1.1.1.170-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440345 440345] | |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.389311.html 389311] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16495 16495] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04453 C04453] | ||
| + | * HMDB : HMDB11606 | ||
| + | {{#set: smiles=CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N}} | ||
| + | {{#set: common name=4α-methyl-5α-cholest-7-en-3-one}} | ||
| + | {{#set: molecular weight=398.671 }} | ||
| + | {{#set: consumed or produced by=1.1.1.170-RXN}} | ||
Revision as of 16:22, 10 January 2018
Contents
Metabolite 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON
- smiles:
- CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N
- common name:
- 4α-methyl-5α-cholest-7-en-3-one
- molecular weight:
- 398.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
