Difference between revisions of "Tiso gene 18783"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * smiles: ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3550 == * left end position: ** 6783 * transcription direction: ** NEGATIVE * right end position: ** 10783 * centisome position: ** 41.1914...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
+
== Gene Tiso_gene_3550 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 6783
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-trans-3-oxo-undecenoyl-CoA
+
** 10783
−
* molecular weight:
+
* centisome position:
−
** 943.749    
+
** 41.191475    
 
* Synonym(s):
 
* Synonym(s):
−
** 4E-3-oxo-undecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14793]]
+
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
* [[RXN-17892]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN-17893]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7799]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6783}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=10783}}
−
{{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}}
+
{{#set: centisome position=41.191475   }}
−
{{#set: common name=4-trans-3-oxo-undecenoyl-CoA}}
+
{{#set: reaction associated=ACYLAMINOACYL-PEPTIDASE-RXN|RXN-17892|RXN-17893}}
−
{{#set: molecular weight=943.749   }}
+
{{#set: pathway associated=PWY-7799}}
−
{{#set: common name=4E-3-oxo-undecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14793}}
+

Revision as of 15:37, 10 January 2018

Gene Tiso_gene_3550

  • left end position:
    • 6783
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 10783
  • centisome position:
    • 41.191475
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18783&oldid=9798"