Difference between revisions of "CPD1F-140"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine26-in-tRNA Guanine26-in-tRNA] == * common name: ** a guanine26 in tRNA * Synonym(s): ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == |
+ | * smiles: | ||
+ | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O))) | ||
* common name: | * common name: | ||
− | ** | + | ** gibberellin A20 |
+ | * inchi key: | ||
+ | ** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M | ||
+ | * molecular weight: | ||
+ | ** 331.388 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** GA20 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-113]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN1F-169]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035] | ||
+ | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
+ | {{#set: common name=gibberellin A20}} | ||
+ | {{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}} | ||
+ | {{#set: molecular weight=331.388 }} | ||
+ | {{#set: common name=GA20}} | ||
+ | {{#set: consumed by=RXN-113}} | ||
+ | {{#set: produced by=RXN1F-169}} |
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD1F-140
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A20
- inchi key:
- InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
- molecular weight:
- 331.388
- Synonym(s):
- GA20
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.