Difference between revisions of "Tiso gene 13306"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * common name: ** L-arginine * inchi k...") |
(Created page with "Category:Gene == Gene Tiso_gene_13306 == * right end position: ** 6380 * transcription direction: ** POSITIVE * left end position: ** 3486 * centisome position: ** 54.5710...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13306 == |
− | * | + | * right end position: |
− | ** | + | ** 6380 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3486 |
− | * | + | * centisome position: |
− | ** | + | ** 54.571068 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.2.1.21-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-10769]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-10773]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-13602]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-13603]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14179]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-5341]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-8036]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9674]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-3121]] | ||
+ | * [[PWY-6002]] | ||
+ | * [[PWY-6788]] | ||
+ | * [[PWY-5176]] | ||
+ | * [[PWY-7092]] | ||
+ | * [[PWY-7091]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6380}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3486}} | |
− | + | {{#set: centisome position=54.571068 }} | |
− | + | {{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}} | |
− | + | {{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:23, 21 March 2018
Gene Tiso_gene_13306
- right end position:
- 6380
- transcription direction:
- POSITIVE
- left end position:
- 3486
- centisome position:
- 54.571068
- Synonym(s):
Reactions associated
- Reaction: 3.2.1.21-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-10769
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-10773
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-13602
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-13603
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-14179
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-5341
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-8036
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-9674
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation