Difference between revisions of "DNNH"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) * co...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNNH DNNH] == * direction: ** LEFT-TO-RIGHT * common name: ** deamino-NAD+ nucleotidohydrolase * Sy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNNH DNNH] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** deamino-NAD+ nucleotidohydrolase |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1.0 [[DEAMIDO-NAD]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[AMP]][c] '''+''' 1.0 [[NICOTINATE_NUCLEOTIDE]][c] '''+''' 2.0 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 nicotinate adenine dinucleotide[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 AMP[c] '''+''' 1.0 β-nicotinate D-ribonucleotide[c] '''+''' 2.0 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9180]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_7189]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_2918]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_2747]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=deamino-NAD+ nucleotidohydrolase}} | |
− | + | {{#set: gene associated=Tiso_gene_9180|Tiso_gene_7189|Tiso_gene_2918|Tiso_gene_2747}} | |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: common name= | + | {{#set: reconstruction source=orthology-creinhardtii}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:23, 21 March 2018
Contents
Reaction DNNH
- direction:
- LEFT-TO-RIGHT
- common name:
- deamino-NAD+ nucleotidohydrolase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 DEAMIDO-NAD[c] + 1.0 WATER[c] => 1.0 AMP[c] + 1.0 NICOTINATE_NUCLEOTIDE[c] + 2.0 PROTON[c]
- With common name(s):
- 1.0 nicotinate adenine dinucleotide[c] + 1.0 H2O[c] => 1.0 AMP[c] + 1.0 β-nicotinate D-ribonucleotide[c] + 2.0 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9180
- Source: orthology-creinhardtii
- Gene: Tiso_gene_7189
- Source: orthology-creinhardtii
- Gene: Tiso_gene_2918
- Source: orthology-creinhardtii
- Gene: Tiso_gene_2747
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii