Difference between revisions of "DNNH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) * co...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNNH DNNH] == * direction: ** LEFT-TO-RIGHT * common name: ** deamino-NAD+ nucleotidohydrolase * Sy...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNNH DNNH] ==
−
* smiles:
+
* direction:
−
** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** p-nitrophenyl-α-D-galactopyranoside
+
** deamino-NAD+ nucleotidohydrolase
−
* inchi key:
+
−
** InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N
+
−
* molecular weight:
+
−
** 301.252   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-nitrophenyl-α-D-galactopyranoside
 
−
** 4-nitrophenyl-α-D-galactoside
 
−
** p-nitrophenyl-α-D-galactoside
 
−
** pNPαGal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17830]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[DEAMIDO-NAD]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[AMP]][c] '''+''' 1.0 [[NICOTINATE_NUCLEOTIDE]][c] '''+''' 2.0 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 nicotinate adenine dinucleotide[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 AMP[c] '''+''' 1.0 β-nicotinate D-ribonucleotide[c] '''+''' 2.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9180]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_7189]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_2918]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_2747]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=82000 82000]
+
{{#set: common name=deamino-NAD+ nucleotidohydrolase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_9180|Tiso_gene_7189|Tiso_gene_2918|Tiso_gene_2747}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=546840 546840]
+
{{#set: in pathway=}}
−
{{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=p-nitrophenyl-α-D-galactopyranoside}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: inchi key=InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=301.252    }}
+
−
{{#set: common name=4-nitrophenyl-α-D-galactopyranoside|4-nitrophenyl-α-D-galactoside|p-nitrophenyl-α-D-galactoside|pNPαGal}}
+
−
{{#set: consumed by=RXN-17830}}
+

Latest revision as of 19:23, 21 March 2018

Reaction DNNH

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • deamino-NAD+ nucleotidohydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 nicotinate adenine dinucleotide[c] + 1.0 H2O[c] => 1.0 AMP[c] + 1.0 β-nicotinate D-ribonucleotide[c] + 2.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DNNH&oldid=41331"