Difference between revisions of "PWY-6857"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * common...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6857 PWY-6857] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6857 PWY-6857] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
* common name: | * common name: | ||
− | ** | + | ** retinol biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** vitamin A biosynthesis |
− | ** | + | ** retinal biosynthesis |
+ | ** retinoid biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''3''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[RXN-12575]] | |
− | * [[RXN- | + | ** 13 associated gene(s): |
− | * [[3 | + | *** [[Tiso_gene_11351]] |
− | == Reaction(s) | + | *** [[Tiso_gene_1537]] |
+ | *** [[Tiso_gene_4606]] | ||
+ | *** [[Tiso_gene_17029]] | ||
+ | *** [[Tiso_gene_1538]] | ||
+ | *** [[Tiso_gene_9429]] | ||
+ | *** [[Tiso_gene_19778]] | ||
+ | *** [[Tiso_gene_4650]] | ||
+ | *** [[Tiso_gene_12686]] | ||
+ | *** [[Tiso_gene_10066]] | ||
+ | *** [[Tiso_gene_16518]] | ||
+ | *** [[Tiso_gene_1922]] | ||
+ | *** [[Tiso_gene_2556]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-12579]] | ||
+ | ** 23 associated gene(s): | ||
+ | *** [[Tiso_gene_2108]] | ||
+ | *** [[Tiso_gene_17612]] | ||
+ | *** [[Tiso_gene_3215]] | ||
+ | *** [[Tiso_gene_17639]] | ||
+ | *** [[Tiso_gene_11437]] | ||
+ | *** [[Tiso_gene_8902]] | ||
+ | *** [[Tiso_gene_17613]] | ||
+ | *** [[Tiso_gene_9140]] | ||
+ | *** [[Tiso_gene_288]] | ||
+ | *** [[Tiso_gene_17614]] | ||
+ | *** [[Tiso_gene_2109]] | ||
+ | *** [[Tiso_gene_14063]] | ||
+ | *** [[Tiso_gene_16817]] | ||
+ | *** [[Tiso_gene_14062]] | ||
+ | *** [[Tiso_gene_17143]] | ||
+ | *** [[Tiso_gene_7915]] | ||
+ | *** [[Tiso_gene_14109]] | ||
+ | *** [[Tiso_gene_5716]] | ||
+ | *** [[Tiso_gene_2983]] | ||
+ | *** [[Tiso_gene_905]] | ||
+ | *** [[Tiso_gene_19184]] | ||
+ | *** [[Tiso_gene_14064]] | ||
+ | *** [[Tiso_gene_906]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-13374]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_13078]] | ||
+ | *** [[Tiso_gene_4653]] | ||
+ | *** [[Tiso_gene_7740]] | ||
+ | *** [[Tiso_gene_13079]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.135-RXN 2.3.1.135-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10841 RXN-10841] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12548 RXN-12548] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12549 RXN-12549] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: common name=retinol biosynthesis}} | |
− | + | {{#set: common name=vitamin A biosynthesis|retinal biosynthesis|retinoid biosynthesis}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=43.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:25, 21 March 2018
Pathway PWY-6857
- taxonomic range:
- common name:
- retinol biosynthesis
- Synonym(s):
- vitamin A biosynthesis
- retinal biosynthesis
- retinoid biosynthesis
Reaction(s) found
3 reactions found over 7 reactions in the full pathway
- RXN-12575
- 13 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-12579
- 23 associated gene(s):
- Tiso_gene_2108
- Tiso_gene_17612
- Tiso_gene_3215
- Tiso_gene_17639
- Tiso_gene_11437
- Tiso_gene_8902
- Tiso_gene_17613
- Tiso_gene_9140
- Tiso_gene_288
- Tiso_gene_17614
- Tiso_gene_2109
- Tiso_gene_14063
- Tiso_gene_16817
- Tiso_gene_14062
- Tiso_gene_17143
- Tiso_gene_7915
- Tiso_gene_14109
- Tiso_gene_5716
- Tiso_gene_2983
- Tiso_gene_905
- Tiso_gene_19184
- Tiso_gene_14064
- Tiso_gene_906
- 3 reconstruction source(s) associated:
- 23 associated gene(s):
- RXN-13374
- 4 associated gene(s):
- 1 reconstruction source(s) associated: