Difference between revisions of "RXN-7648"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-882 CPD0-882] == * smiles: ** CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2)) * common name:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7648 RXN-7648] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-882 CPD0-882] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7648 RXN-7648] ==
−
* smiles:
+
* direction:
−
** CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** 1,6-anhydro-N-acetyl-β-muramate
+
** [http://enzyme.expasy.org/EC/1.14.11.9 EC-1.14.11.9]
−
* inchi key:
+
−
** InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M
+
−
* molecular weight:
+
−
** 274.25   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1,6-anhMurNAc
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN0-5226]]
+
** 1 [[CPD-6991]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-6992]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SUC]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (2S)-pinocembrin[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''=>''' 1 (+)-pinobanksin[c] '''+''' 1 CO2[c] '''+''' 1 succinate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3330]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5059]], pinobanksin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5059 PWY-5059]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658592 90658592]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07993 R07993]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.4883322.html 4883322]
+
{{#set: ec number=EC-1.14.11.9}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3330}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58690 58690]
+
{{#set: in pathway=PWY-5059}}
−
* BIGG : anhm
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: common name=1,6-anhydro-N-acetyl-β-muramate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M}}
+
−
{{#set: molecular weight=274.25    }}
+
−
{{#set: common name=1,6-anhMurNAc}}
+
−
{{#set: produced by=RXN0-5226}}
+

Latest revision as of 19:26, 21 March 2018

Reaction RXN-7648

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5059, pinobanksin biosynthesis: PWY-5059
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7648&oldid=41586"