Difference between revisions of "RXN-14503"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * common name: ** pr...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14503 RXN-14503] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14503 RXN-14503] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[CPD-15377]][c] '''<=>''' 1 [[D-Xylopyranose]][c] |
− | == | + | * With common name(s): |
+ | ** 1 aldehydo-D-xylose[c] '''<=>''' 1 D-xylopyranose[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:27, 21 March 2018
Contents
Reaction RXN-14503
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-15377[c] <=> 1 D-Xylopyranose[c]
- With common name(s):
- 1 aldehydo-D-xylose[c] <=> 1 D-xylopyranose[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation