Difference between revisions of "Tiso gene 18052"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Gene == Gene Tiso_gene_18052 == * right end position: ** 3002 * transcription direction: ** NEGATIVE * left end position: ** 462 * centisome position: ** 8.248528...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18052 == |
− | * | + | * right end position: |
− | ** | + | ** 3002 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 462 |
− | * | + | * centisome position: |
− | ** | + | ** 8.248528 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GPH-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
+ | * [[PWY-181]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3002}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=462}} | |
− | + | {{#set: centisome position=8.248528 }} | |
− | + | {{#set: reaction associated=GPH-RXN}} | |
− | + | {{#set: pathway associated=PWY-181}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:30, 21 March 2018
Gene Tiso_gene_18052
- right end position:
- 3002
- transcription direction:
- NEGATIVE
- left end position:
- 462
- centisome position:
- 8.248528
- Synonym(s):
Reactions associated
- Reaction: GPH-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation