Difference between revisions of "AMINOPARATHION-PHOSPHATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * common name:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOPARATHION-PHOSPHATASE-RXN AMINOPARATHION-PHOSPHATASE-RXN] == * direction: ** LEFT-TO-RIGHT * c...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOPARATHION-PHOSPHATASE-RXN AMINOPARATHION-PHOSPHATASE-RXN] ==
−
* smiles:
+
* direction:
−
** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** γ-L-glutamyl-glycylglycine
+
** Aminoparathion hydrolase
−
* inchi key:
+
* ec number:
−
** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
+
** [http://enzyme.expasy.org/EC/3.1.8.1 EC-3.1.8.1]
−
* molecular weight:
+
−
** 260.226   
+
 
* Synonym(s):
 
* Synonym(s):
−
** γ-L-Glu-Gly-Gly
+
** Paraoxonase
 +
** aminoparathion phosphatase
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-18092]]
+
** 1 [[AMINO-PARATHION]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DIETHYLTHIOPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-259]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 amino-parathion[c] '''+''' 1 H2O[c] '''=>''' 1 diethylthiophosphate[c] '''+''' 1 H+[c] '''+''' 1 4-aminophenol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9894]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=γ-L-glutamyl-glycylglycine}}
+
{{#set: common name=Aminoparathion hydrolase}}
−
{{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}}
+
{{#set: ec number=EC-3.1.8.1}}
−
{{#set: molecular weight=260.226    }}
+
{{#set: common name=Paraoxonase|aminoparathion phosphatase}}
−
{{#set: common name=γ-L-Glu-Gly-Gly}}
+
{{#set: gene associated=Tiso_gene_9894}}
−
{{#set: produced by=RXN-18092}}
+
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:31, 21 March 2018

Reaction AMINOPARATHION-PHOSPHATASE-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Aminoparathion hydrolase
  • ec number:
  • Synonym(s):
    • Paraoxonase
    • aminoparathion phosphatase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=AMINOPARATHION-PHOSPHATASE-RXN&oldid=42167"