Difference between revisions of "CPD-17420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * common name: ** dehydro-D-arabino...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
| − | ** | + | ** 6-hydroxytyphasterol |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 450.701 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-4241]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372] |
| − | + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | |
| − | + | {{#set: common name=6-hydroxytyphasterol}} | |
| − | + | {{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}} | |
| − | + | {{#set: molecular weight=450.701 }} | |
| − | {{#set: smiles=C( | + | {{#set: produced by=RXN-4241}} |
| − | {{#set: common name= | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: molecular weight= | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite CPD-17420
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 6-hydroxytyphasterol
- inchi key:
- InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
- molecular weight:
- 450.701
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
