Difference between revisions of "S-Substituted-Glutathione"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-Glutathione S-Substituted-Glutathione] == * common name: ** a glutathione-toxin c...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-Glutathione S-Substituted-Glutathione] ==
* smiles:
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
 
* common name:
 
* common name:
** 6-hydroxytyphasterol
+
** a glutathione-toxin conjugate
* inchi key:
+
** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
+
* molecular weight:
+
** 450.701   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** S-substituted glutathione
 +
** R-S-G
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4241]]
+
* [[GSHTRAN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a glutathione-toxin conjugate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372]
+
{{#set: common name=S-substituted glutathione|R-S-G}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: produced by=GSHTRAN-RXN}}
{{#set: common name=6-hydroxytyphasterol}}
+
{{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}}
+
{{#set: molecular weight=450.701    }}
+
{{#set: produced by=RXN-4241}}
+

Latest revision as of 19:37, 21 March 2018

Metabolite S-Substituted-Glutathione

  • common name:
    • a glutathione-toxin conjugate
  • Synonym(s):
    • S-substituted glutathione
    • R-S-G

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links