Difference between revisions of "3.4.21.4-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * common n...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.4-RXN 3.4.21.4-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** trypsin_family ** try...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.4-RXN 3.4.21.4-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** trypsin_family |
− | * | + | ** trypsin |
− | * | + | * ec number: |
− | * | + | ** [http://enzyme.expasy.org/EC/3.4.21.4 EC-3.4.21.4] |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[General-Protein-Substrates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Peptides-holder]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 a protein[c] '''+''' 1 H2O[c] '''=>''' 1 a peptide[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_17883]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_4147]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_1997]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_1341]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_20549]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_13684]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_13074]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_2777]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_19324]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_1761]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_4842]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_8820]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_12875]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P07477 P07477] |
− | * | + | ** [http://www.uniprot.org/uniprot/P08426 P08426] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P35051 P35051] |
− | * | + | ** [http://www.uniprot.org/uniprot/P19799 P19799] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M434 Q7M434] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q7M435 Q7M435] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M390 Q7M390] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7LZP8 Q7LZP8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7LZF8 Q7LZF8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M433 Q7M433] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P07146 P07146] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P07478 P07478] |
+ | ** [http://www.uniprot.org/uniprot/Q7M3N1 Q7M3N1] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M432 Q7M432] | ||
+ | ** [http://www.uniprot.org/uniprot/P32821 P32821] | ||
+ | ** [http://www.uniprot.org/uniprot/P32822 P32822] | ||
+ | ** [http://www.uniprot.org/uniprot/P12788 P12788] | ||
+ | ** [http://www.uniprot.org/uniprot/P35050 P35050] | ||
+ | ** [http://www.uniprot.org/uniprot/Q29463 Q29463] | ||
+ | ** [http://www.uniprot.org/uniprot/P35034 P35034] | ||
+ | ** [http://www.uniprot.org/uniprot/P35031 P35031] | ||
+ | ** [http://www.uniprot.org/uniprot/P35032 P35032] | ||
+ | ** [http://www.uniprot.org/uniprot/P35033 P35033] | ||
+ | ** [http://www.uniprot.org/uniprot/P35030 P35030] | ||
+ | ** [http://www.uniprot.org/uniprot/P35035 P35035] | ||
+ | ** [http://www.uniprot.org/uniprot/P35036 P35036] | ||
+ | ** [http://www.uniprot.org/uniprot/P16049 P16049] | ||
+ | ** [http://www.uniprot.org/uniprot/Q91041 Q91041] | ||
+ | ** [http://www.uniprot.org/uniprot/P35038 P35038] | ||
+ | ** [http://www.uniprot.org/uniprot/P35041 P35041] | ||
+ | ** [http://www.uniprot.org/uniprot/P35037 P35037] | ||
+ | ** [http://www.uniprot.org/uniprot/Q92099 Q92099] | ||
+ | ** [http://www.uniprot.org/uniprot/Q27761 Q27761] | ||
+ | ** [http://www.uniprot.org/uniprot/Q90629 Q90629] | ||
+ | ** [http://www.uniprot.org/uniprot/Q90628 Q90628] | ||
+ | ** [http://www.uniprot.org/uniprot/Q90627 Q90627] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M436 Q7M436] | ||
+ | ** [http://www.uniprot.org/uniprot/P35045 P35045] | ||
+ | ** [http://www.uniprot.org/uniprot/P00765 P00765] | ||
+ | ** [http://www.uniprot.org/uniprot/P00764 P00764] | ||
+ | ** [http://www.uniprot.org/uniprot/P06872 P06872] | ||
+ | ** [http://www.uniprot.org/uniprot/P06871 P06871] | ||
+ | ** [http://www.uniprot.org/uniprot/P00761 P00761] | ||
+ | ** [http://www.uniprot.org/uniprot/P00762 P00762] | ||
+ | ** [http://www.uniprot.org/uniprot/P00763 P00763] | ||
+ | ** [http://www.uniprot.org/uniprot/P00775 P00775] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=trypsin_family}} | ||
+ | {{#set: common name=trypsin}} | ||
+ | {{#set: ec number=EC-3.4.21.4}} | ||
+ | {{#set: gene associated=Tiso_gene_17883|Tiso_gene_4147|Tiso_gene_1997|Tiso_gene_1341|Tiso_gene_20549|Tiso_gene_13684|Tiso_gene_13074|Tiso_gene_2777|Tiso_gene_19324|Tiso_gene_1761|Tiso_gene_4842|Tiso_gene_8820|Tiso_gene_12875}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:37, 21 March 2018
Contents
Reaction 3.4.21.4-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- trypsin_family
- trypsin
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 General-Protein-Substrates[c] + 1 WATER[c] => 1 Peptides-holder[c]
- With common name(s):
- 1 a protein[c] + 1 H2O[c] => 1 a peptide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17883
- Source: orthology-esiliculosus
- Gene: Tiso_gene_4147
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1997
- Source: orthology-esiliculosus
- Gene: Tiso_gene_1341
- Source: orthology-esiliculosus
- Gene: Tiso_gene_20549
- Source: orthology-esiliculosus
- Gene: Tiso_gene_13684
- Source: orthology-esiliculosus
- Gene: Tiso_gene_13074
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2777
- Source: orthology-esiliculosus
- Gene: Tiso_gene_19324
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1761
- Source: orthology-esiliculosus
- Gene: Tiso_gene_4842
- Source: orthology-esiliculosus
- Gene: Tiso_gene_8820
- Source: orthology-esiliculosus
- Gene: Tiso_gene_12875
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- UNIPROT:
- P07477
- P08426
- P35051
- P19799
- Q7M434
- Q7M435
- Q7M390
- Q7LZP8
- Q7LZF8
- Q7M433
- P07146
- P07478
- Q7M3N1
- Q7M432
- P32821
- P32822
- P12788
- P35050
- Q29463
- P35034
- P35031
- P35032
- P35033
- P35030
- P35035
- P35036
- P16049
- Q91041
- P35038
- P35041
- P35037
- Q92099
- Q27761
- Q90629
- Q90628
- Q90627
- Q7M436
- P35045
- P00765
- P00764
- P06872
- P06871
- P00761
- P00762
- P00763
- P00775